C35H37NO5 — CID 163810203
[(2R,3R,4R,5S,6Z)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethylidene)oxan-2-yl]methanamine (PubChem CID 163810203) has the molecular formula C35H37NO5 and a molecular weight of 551.68 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6Z)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethylidene)oxan-2-yl]methanamine.
| Compound Name | [(2R,3R,4R,5S,6Z)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethylidene)oxan-2-yl]methanamine |
|---|---|
| PubChem CID | 163810203 |
| Molecular Formula | C35H37NO5 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | [(2R,3R,4R,5S,6Z)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethylidene)oxan-2-yl]methanamine |
| SMILES | NC[C@H]1O/C(=C\OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H37NO5/c36-21-31-33(38-23-28-15-7-2-8-16-28)35(40-25-30-19-11-4-12-20-30)34(39-24-29-17-9-3-10-18-29)32(41-31)26-37-22-27-13-5-1-6-14-27/h1-20,26,31,33-35H,21-25,36H2/b32-26-/t31-,33-,34-,35-/m1/s1 |
| InChIKey | NMOXJPJDJZALNN-SKIKZRLXSA-N |
| XLogP | 6.16 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|