C30H32O7 — CID 73106838
[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-ylidene]methyl acetate (PubChem CID 73106838) has the molecular formula C30H32O7 and a molecular weight of 504.58 g/mol. Its IUPAC name is [6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-ylidene]methyl acetate.
| Compound Name | [6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-ylidene]methyl acetate |
|---|---|
| PubChem CID | 73106838 |
| Molecular Formula | C30H32O7 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | [6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-ylidene]methyl acetate |
| SMILES | COC1OC(=COC(C)=O)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C30H32O7/c1-22(31)33-21-26-27(34-18-23-12-6-3-7-13-23)28(35-19-24-14-8-4-9-15-24)29(30(32-2)37-26)36-20-25-16-10-5-11-17-25/h3-17,21,27-30H,18-20H2,1-2H3 |
| InChIKey | OEDHUQCWQOCUCM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|