C28H28O7 — CID 155351672
[(2R,3R,4S,5R)-6-oxo-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate (PubChem CID 155351672) has the molecular formula C28H28O7 and a molecular weight of 476.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-oxo-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-6-oxo-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 155351672 |
| Molecular Formula | C28H28O7 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | [(2R,3R,4S,5R)-6-oxo-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1OC(=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H28O7/c1-20(29)34-28-26(33-19-23-15-9-4-10-16-23)24(31-17-21-11-5-2-6-12-21)25(27(30)35-28)32-18-22-13-7-3-8-14-22/h2-16,24-26,28H,17-19H2,1H3/t24-,25-,26-,28-/m1/s1 |
| InChIKey | LVMVMSIEJBTVBQ-IYUNARRTSA-N |
| XLogP | 4.19 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |