C18H26O7 — CID 10247548
(2S,3R,4S,5S)-2-methoxy-4,5-bis(methoxymethoxy)-6-methylidene-3-phenylmethoxyoxane (PubChem CID 10247548) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-methoxy-4,5-bis(methoxymethoxy)-6-methylidene-3-phenylmethoxyoxane.
| Compound Name | (2S,3R,4S,5S)-2-methoxy-4,5-bis(methoxymethoxy)-6-methylidene-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 10247548 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2S,3R,4S,5S)-2-methoxy-4,5-bis(methoxymethoxy)-6-methylidene-3-phenylmethoxyoxane |
| SMILES | C=C1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCOC)[C@@H]1OCOC |
| InChI | InChI=1S/C18H26O7/c1-13-15(23-11-19-2)16(24-12-20-3)17(18(21-4)25-13)22-10-14-8-6-5-7-9-14/h5-9,15-18H,1,10-12H2,2-4H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | PXAXUGZAZDMQFK-XDNAFOTISA-N |
| XLogP | 2.07 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|