C48H52O10 — CID 10581132
(2S,3R,4R,5R,6R)-2-methoxy-6-[[(2S,3R,4S,5S)-6-methylidene-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]-4,5-bis(phenylmethoxy)oxan-3-ol (PubChem CID 10581132) has the molecular formula C48H52O10 and a molecular weight of 788.93 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-methoxy-6-[[(2S,3R,4S,5S)-6-methylidene-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]-4,5-bis(phenylmethoxy)oxan-3-ol.
| Compound Name | (2S,3R,4R,5R,6R)-2-methoxy-6-[[(2S,3R,4S,5S)-6-methylidene-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]-4,5-bis(phenylmethoxy)oxan-3-ol |
|---|---|
| PubChem CID | 10581132 |
| Molecular Formula | C48H52O10 |
| Molecular Weight | 788.93 g/mol |
| Exact Mass | 788.36 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-methoxy-6-[[(2S,3R,4S,5S)-6-methylidene-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]-4,5-bis(phenylmethoxy)oxan-3-ol |
| SMILES | C=C1O[C@H](OC[C@H]2O[C@H](OC)[C@H](O)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H52O10/c1-34-42(51-28-35-18-8-3-9-19-35)45(54-31-38-24-14-6-15-25-38)46(55-32-39-26-16-7-17-27-39)48(57-34)56-33-40-43(52-29-36-20-10-4-11-21-36)44(41(49)47(50-2)58-40)53-30-37-22-12-5-13-23-37/h3-27,40-49H,1,28-33H2,2H3/t40-,41-,42-,43-,44-,45+,46-,47+,48+/m1/s1 |
| InChIKey | CKJYCFUXUSDKLH-UBRBJGGMSA-N |
| XLogP | 7.53 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.93 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |