C23H36O7Si — CID 10456547
3-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxan-2-yl]prop-1-ynyl-trimethylsilane (PubChem CID 10456547) has the molecular formula C23H36O7Si and a molecular weight of 452.62 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxan-2-yl]prop-1-ynyl-trimethylsilane.
| Compound Name | 3-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxan-2-yl]prop-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 10456547 |
| Molecular Formula | C23H36O7Si |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 3-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxan-2-yl]prop-1-ynyl-trimethylsilane |
| SMILES | COCO[C@@H]1[C@@H](OCOC)[C@@H](OC)O[C@H](CC#C[Si](C)(C)C)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H36O7Si/c1-24-16-28-21-20(27-15-18-11-8-7-9-12-18)19(13-10-14-31(4,5)6)30-23(26-3)22(21)29-17-25-2/h7-9,11-12,19-23H,13,15-17H2,1-6H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | HQUMMWAIQGVEHI-ZQGJOIPISA-N |
| XLogP | 3.19 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|