C22H34O7S2 — CID 10390158
(2R,3R,4S,5R,6S)-2-(1,3-dithian-2-ylmethyl)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane (PubChem CID 10390158) has the molecular formula C22H34O7S2 and a molecular weight of 474.64 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(1,3-dithian-2-ylmethyl)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane.
| Compound Name | (2R,3R,4S,5R,6S)-2-(1,3-dithian-2-ylmethyl)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 10390158 |
| Molecular Formula | C22H34O7S2 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(1,3-dithian-2-ylmethyl)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane |
| SMILES | COCO[C@@H]1[C@@H](OCOC)[C@@H](OC)O[C@H](CC2SCCCS2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H34O7S2/c1-23-14-27-20-19(26-13-16-8-5-4-6-9-16)17(12-18-30-10-7-11-31-18)29-22(25-3)21(20)28-15-24-2/h4-6,8-9,17-22H,7,10-15H2,1-3H3/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | HUQCJWQLTYUKQH-VOFPXKNKSA-N |
| XLogP | 3.51 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|