C32H38O5S2 — CID 11478607
(2R,3R,4S,5S,6S)-2-(1,3-dithian-2-ylmethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 11478607) has the molecular formula C32H38O5S2 and a molecular weight of 566.79 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-2-(1,3-dithian-2-ylmethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2R,3R,4S,5S,6S)-2-(1,3-dithian-2-ylmethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 11478607 |
| Molecular Formula | C32H38O5S2 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | (2R,3R,4S,5S,6S)-2-(1,3-dithian-2-ylmethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | CO[C@H]1O[C@H](CC2SCCCS2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H38O5S2/c1-33-32-31(36-23-26-16-9-4-10-17-26)30(35-22-25-14-7-3-8-15-25)29(34-21-24-12-5-2-6-13-24)27(37-32)20-28-38-18-11-19-39-28/h2-10,12-17,27-32H,11,18-23H2,1H3/t27-,29-,30+,31+,32+/m1/s1 |
| InChIKey | YBXVLTYKHYIUSC-AIXQGADWSA-N |
| XLogP | 6.70 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |