C28H28F2O5 — CID 162538393
(3S,4S,5R,6S)-2-(difluoromethylidene)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 162538393) has the molecular formula C28H28F2O5 and a molecular weight of 482.52 g/mol. Its IUPAC name is (3S,4S,5R,6S)-2-(difluoromethylidene)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (3S,4S,5R,6S)-2-(difluoromethylidene)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 162538393 |
| Molecular Formula | C28H28F2O5 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | (3S,4S,5R,6S)-2-(difluoromethylidene)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | CO[C@H]1OC(=C(F)F)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H28F2O5/c1-31-28-26(34-19-22-15-9-4-10-16-22)24(33-18-21-13-7-3-8-14-21)23(25(35-28)27(29)30)32-17-20-11-5-2-6-12-20/h2-16,23-24,26,28H,17-19H2,1H3/t23-,24-,26+,28-/m0/s1 |
| InChIKey | SILZQYJHWIQILT-XWZVPRMZSA-N |
| XLogP | 5.85 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |