C21H26O6 — CID 563648
1-[5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]ethane-1,2-diol (PubChem CID 563648) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is 1-[5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]ethane-1,2-diol.
| Compound Name | 1-[5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 563648 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-[5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]ethane-1,2-diol |
| SMILES | COC1OC(C(O)CO)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C21H26O6/c1-24-21-20(26-14-16-10-6-3-7-11-16)19(18(27-21)17(23)12-22)25-13-15-8-4-2-5-9-15/h2-11,17-23H,12-14H2,1H3 |
| InChIKey | IEUQWJFYEPQBON-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |