C30H32O6 — CID 132597133
1-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-yn-1-ol (PubChem CID 132597133) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-yn-1-ol.
| Compound Name | 1-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 132597133 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 1-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-yn-1-ol |
| SMILES | C#CC(O)[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H32O6/c1-3-25(31)26-27(33-19-22-13-7-4-8-14-22)28(34-20-23-15-9-5-10-16-23)29(30(32-2)36-26)35-21-24-17-11-6-12-18-24/h1,4-18,25-31H,19-21H2,2H3/t25?,26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | DEPWYGDFFRBGMF-CGZQQOGFSA-N |
| XLogP | 4.11 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|