C46H54O7Si — CID 23242968
(1R)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-1-ol (PubChem CID 23242968) has the molecular formula C46H54O7Si and a molecular weight of 747.02 g/mol. Its IUPAC name is (1R)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-1-ol.
| Compound Name | (1R)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 23242968 |
| Molecular Formula | C46H54O7Si |
| Molecular Weight | 747.02 g/mol |
| Exact Mass | 746.36 |
| IUPAC Name | (1R)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propan-1-ol |
| SMILES | CO[C@H]1O[C@H]([C@H](O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C46H54O7Si/c1-46(2,3)54(38-26-16-8-17-27-38,39-28-18-9-19-29-39)52-31-30-40(47)41-42(49-32-35-20-10-5-11-21-35)43(50-33-36-22-12-6-13-23-36)44(45(48-4)53-41)51-34-37-24-14-7-15-25-37/h5-29,40-45,47H,30-34H2,1-4H3/t40-,41-,42-,43+,44-,45+/m1/s1 |
| InChIKey | ISBXUCZOXLAWJV-YUPNJTAXSA-N |
| XLogP | 7.44 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.02 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|