C47H64O11Si — CID 91336528
(3R,4S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,6-dimethoxy-5-phenylmethoxyoxan-3-ol;(3R,4S,6S)-2-ethyl-4,6-dimethoxy-5-phenylmethoxyoxan-3-ol (PubChem CID 91336528) has the molecular formula C47H64O11Si and a molecular weight of 833.10 g/mol. Its IUPAC name is (3R,4S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,6-dimethoxy-5-phenylmethoxyoxan-3-ol;(3R,4S,6S)-2-ethyl-4,6-dimethoxy-5-phenylmethoxyoxan-3-ol.
| Compound Name | (3R,4S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,6-dimethoxy-5-phenylmethoxyoxan-3-ol;(3R,4S,6S)-2-ethyl-4,6-dimethoxy-5-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 91336528 |
| Molecular Formula | C47H64O11Si |
| Molecular Weight | 833.10 g/mol |
| Exact Mass | 832.42 |
| IUPAC Name | (3R,4S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,6-dimethoxy-5-phenylmethoxyoxan-3-ol;(3R,4S,6S)-2-ethyl-4,6-dimethoxy-5-phenylmethoxyoxan-3-ol |
| SMILES | CCC1O[C@H](OC)C(OCc2ccccc2)[C@@H](OC)[C@@H]1O.CO[C@H]1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H](OC)C1OCc1ccccc1 |
| InChI | InChI=1S/C31H40O6Si.C16H24O5/c1-31(2,3)38(24-17-11-7-12-18-24,25-19-13-8-14-20-25)36-22-26-27(32)28(33-4)29(30(34-5)37-26)35-21-23-15-9-6-10-16-23;1-4-12-13(17)14(18-2)15(16(19-3)21-12)20-10-11-8-6-5-7-9-11/h6-20,26-30,32H,21-22H2,1-5H3;5-9,12-17H,4,10H2,1-3H3/t26?,27-,28+,29?,30+;12?,13-,14+,15?,16+/m11/s1 |
| InChIKey | SSSRVKZCIDBTEN-LZYAZXSASA-N |
| XLogP | 5.62 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.10 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|