C20H34O6Si — CID 102125850
(2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxyoxane-3,5-diol (PubChem CID 102125850) has the molecular formula C20H34O6Si and a molecular weight of 398.57 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxyoxane-3,5-diol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 102125850 |
| Molecular Formula | C20H34O6Si |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxyoxane-3,5-diol |
| SMILES | CO[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C20H34O6Si/c1-20(2,3)27(5,6)25-13-15-16(21)18(17(22)19(23-4)26-15)24-12-14-10-8-7-9-11-14/h7-11,15-19,21-22H,12-13H2,1-6H3/t15-,16+,17-,18+,19+/m1/s1 |
| InChIKey | CSDZCMBDOYKDLF-LFDJNIOPSA-N |
| XLogP | 2.69 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|