C30H37N3O5Si — CID 52918394
(2R,3S,4R,5R,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxyoxan-3-ol (PubChem CID 52918394) has the molecular formula C30H37N3O5Si and a molecular weight of 547.73 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxyoxan-3-ol.
| Compound Name | (2R,3S,4R,5R,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 52918394 |
| Molecular Formula | C30H37N3O5Si |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | (2R,3S,4R,5R,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxyoxan-3-ol |
| SMILES | CO[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C30H37N3O5Si/c1-30(2,3)39(23-16-10-6-11-17-23,24-18-12-7-13-19-24)37-21-25-27(34)28(26(32-33-31)29(35-4)38-25)36-20-22-14-8-5-9-15-22/h5-19,25-29,34H,20-21H2,1-4H3/t25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | BVJTUAVUPWOUFK-JPHCZMGXSA-N |
| XLogP | 4.56 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|