C21H33N3O6Si — CID 86587178
[(2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate (PubChem CID 86587178) has the molecular formula C21H33N3O6Si and a molecular weight of 451.60 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86587178 |
| Molecular Formula | C21H33N3O6Si |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C21H33N3O6Si/c1-14(25)27-13-16-18(26)19(28-12-15-10-8-7-9-11-15)17(23-24-22)20(29-16)30-31(5,6)21(2,3)4/h7-11,16-20,26H,12-13H2,1-6H3/t16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | MOQSPVMKEDFESW-WAPOTWQKSA-N |
| XLogP | 3.92 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|