C15H21N3O4 — CID 70920316
(4R,5S)-5-azido-2-ethyl-6-methoxy-4-phenylmethoxyoxan-3-ol (PubChem CID 70920316) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is (4R,5S)-5-azido-2-ethyl-6-methoxy-4-phenylmethoxyoxan-3-ol.
| Compound Name | (4R,5S)-5-azido-2-ethyl-6-methoxy-4-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 70920316 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | (4R,5S)-5-azido-2-ethyl-6-methoxy-4-phenylmethoxyoxan-3-ol |
| SMILES | CCC1OC(OC)[C@@H](N=[N+]=[N-])[C@@H](OCc2ccccc2)C1O |
| InChI | InChI=1S/C15H21N3O4/c1-3-11-13(19)14(12(17-18-16)15(20-2)22-11)21-9-10-7-5-4-6-8-10/h4-8,11-15,19H,3,9H2,1-2H3/t11?,12-,13?,14+,15?/m0/s1 |
| InChIKey | ABJUABRUEJRVAT-VNECMYLUSA-N |
| XLogP | 2.39 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|