C15H21N3O5 — CID 10448864
(2R,3R,4R,5R,6R)-4-azido-5,6-dimethoxy-2-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 10448864) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-4-azido-5,6-dimethoxy-2-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4R,5R,6R)-4-azido-5,6-dimethoxy-2-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 10448864 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2R,3R,4R,5R,6R)-4-azido-5,6-dimethoxy-2-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CO[C@@H]1O[C@H](COCc2ccccc2)[C@H](O)[C@@H](N=[N+]=[N-])[C@H]1OC |
| InChI | InChI=1S/C15H21N3O5/c1-20-14-12(17-18-16)13(19)11(23-15(14)21-2)9-22-8-10-6-4-3-5-7-10/h3-7,11-15,19H,8-9H2,1-2H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | BHNZHVJQPOOSRU-UXXRCYHCSA-N |
| XLogP | 1.63 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|