C16H23N3O6 — CID 56632277
(2R,3S,4S,5R)-4-azido-5,6-dimethoxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-ol (PubChem CID 56632277) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is (2R,3S,4S,5R)-4-azido-5,6-dimethoxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-ol.
| Compound Name | (2R,3S,4S,5R)-4-azido-5,6-dimethoxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-ol |
|---|---|
| PubChem CID | 56632277 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (2R,3S,4S,5R)-4-azido-5,6-dimethoxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-ol |
| SMILES | COc1ccc(COC[C@H]2OC(OC)[C@H](OC)[C@@H](N=[N+]=[N-])[C@@H]2O)cc1 |
| InChI | InChI=1S/C16H23N3O6/c1-21-11-6-4-10(5-7-11)8-24-9-12-14(20)13(18-19-17)15(22-2)16(23-3)25-12/h4-7,12-16,20H,8-9H2,1-3H3/t12-,13+,14-,15-,16?/m1/s1 |
| InChIKey | LTTSDAXDEVNRJY-KJAHXBPPSA-N |
| XLogP | 1.64 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|