C17H25N3O3 — CID 58183798
(3R,4S)-5-azido-2-[(4-methoxyphenyl)methoxymethyl]-3,4,6-trimethyloxane (PubChem CID 58183798) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is (3R,4S)-5-azido-2-[(4-methoxyphenyl)methoxymethyl]-3,4,6-trimethyloxane.
| Compound Name | (3R,4S)-5-azido-2-[(4-methoxyphenyl)methoxymethyl]-3,4,6-trimethyloxane |
|---|---|
| PubChem CID | 58183798 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (3R,4S)-5-azido-2-[(4-methoxyphenyl)methoxymethyl]-3,4,6-trimethyloxane |
| SMILES | COc1ccc(COCC2OC(C)C(N=[N+]=[N-])[C@@H](C)[C@H]2C)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-11-12(2)17(19-20-18)13(3)23-16(11)10-22-9-14-5-7-15(21-4)8-6-14/h5-8,11-13,16-17H,9-10H2,1-4H3/t11-,12+,13?,16?,17?/m1/s1 |
| InChIKey | NMOKKBZNVKULNQ-JIOPHJCTSA-N |
| XLogP | 3.95 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|