C35H37N3O6 — CID 71613692
(2S,3S,4S,5R,6R)-2-azido-6-[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 71613692) has the molecular formula C35H37N3O6 and a molecular weight of 595.70 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-azido-6-[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2S,3S,4S,5R,6R)-2-azido-6-[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 71613692 |
| Molecular Formula | C35H37N3O6 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-azido-6-[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | COc1ccc(COC[C@H]2O[C@H](N=[N+]=[N-])[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H37N3O6/c1-39-30-19-17-29(18-20-30)21-40-25-31-32(41-22-26-11-5-2-6-12-26)33(42-23-27-13-7-3-8-14-27)34(35(44-31)37-38-36)43-24-28-15-9-4-10-16-28/h2-20,31-35H,21-25H2,1H3/t31-,32-,33+,34+,35+/m1/s1 |
| InChIKey | CXLFSMGYUNLUKC-VABIIVNOSA-N |
| XLogP | 7.00 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|