C29H33N3O5 — CID 159428449
(4R,5S)-3-azido-5-[(4-methoxyphenyl)methoxy]-2-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxane (PubChem CID 159428449) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is (4R,5S)-3-azido-5-[(4-methoxyphenyl)methoxy]-2-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxane.
| Compound Name | (4R,5S)-3-azido-5-[(4-methoxyphenyl)methoxy]-2-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 159428449 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | (4R,5S)-3-azido-5-[(4-methoxyphenyl)methoxy]-2-methyl-4-phenylmethoxy-6-(phenylmethoxymethyl)oxane |
| SMILES | COc1ccc(CO[C@@H]2C(COCc3ccccc3)OC(C)C(N=[N+]=[N-])[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H33N3O5/c1-21-27(31-32-30)29(36-18-23-11-7-4-8-12-23)28(35-19-24-13-15-25(33-2)16-14-24)26(37-21)20-34-17-22-9-5-3-6-10-22/h3-16,21,26-29H,17-20H2,1-2H3/t21?,26?,27?,28-,29-/m1/s1 |
| InChIKey | LQRDWFSZQNESQS-SIOBRPEXSA-N |
| XLogP | 5.85 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|