C37H42FN3O5Si — CID 11802442
[(2R,3S,4R,5R)-5-azido-6-fluoro-3-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 11802442) has the molecular formula C37H42FN3O5Si and a molecular weight of 655.84 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-azido-6-fluoro-3-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2R,3S,4R,5R)-5-azido-6-fluoro-3-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11802442 |
| Molecular Formula | C37H42FN3O5Si |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | [(2R,3S,4R,5R)-5-azido-6-fluoro-3-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | COc1ccc(CO[C@H]2[C@H](OCc3ccccc3)[C@@H](N=[N+]=[N-])C(F)O[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H42FN3O5Si/c1-37(2,3)47(30-16-10-6-11-17-30,31-18-12-7-13-19-31)45-26-32-34(43-25-28-20-22-29(42-4)23-21-28)35(33(40-41-39)36(38)46-32)44-24-27-14-8-5-9-15-27/h5-23,32-36H,24-26H2,1-4H3/t32-,33-,34-,35-,36?/m1/s1 |
| InChIKey | REWMTVDARGEMBG-YBVLYHCMSA-N |
| XLogP | 7.12 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|