C35H47IO6Si — CID 91531895
[(3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]-5,6-dimethyloxan-3-yl] acetate;iodomethane (PubChem CID 91531895) has the molecular formula C35H47IO6Si and a molecular weight of 718.75 g/mol. Its IUPAC name is [(3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]-5,6-dimethyloxan-3-yl] acetate;iodomethane.
| Compound Name | [(3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]-5,6-dimethyloxan-3-yl] acetate;iodomethane |
|---|---|
| PubChem CID | 91531895 |
| Molecular Formula | C35H47IO6Si |
| Molecular Weight | 718.75 g/mol |
| Exact Mass | 718.22 |
| IUPAC Name | [(3S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]-5,6-dimethyloxan-3-yl] acetate;iodomethane |
| SMILES | CI.COc1ccc(COC2C(C)[C@H](C)OC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C34H44O6Si.CH3I/c1-24-25(2)39-31(33(40-26(3)35)32(24)37-22-27-18-20-28(36-7)21-19-27)23-38-41(34(4,5)6,29-14-10-8-11-15-29)30-16-12-9-13-17-30;1-2/h8-21,24-25,31-33H,22-23H2,1-7H3;1H3/t24?,25-,31?,32?,33+;/m0./s1 |
| InChIKey | BHHHPZNPDOYIHI-CJBTWQRSSA-N |
| XLogP | 6.56 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.75 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|