C24H34O10 — CID 11317650
[(2R,3R,4S,5S,6S)-3,5-diacetyloxy-6-methoxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11317650) has the molecular formula C24H34O10 and a molecular weight of 482.53 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,5-diacetyloxy-6-methoxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,5-diacetyloxy-6-methoxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11317650 |
| Molecular Formula | C24H34O10 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,5-diacetyloxy-6-methoxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | COc1ccc(CO[C@@H]2[C@H](OC(C)=O)[C@@H](OC)O[C@H](COC(=O)C(C)(C)C)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C24H34O10/c1-14(25)32-19-18(13-31-23(27)24(3,4)5)34-22(29-7)21(33-15(2)26)20(19)30-12-16-8-10-17(28-6)11-9-16/h8-11,18-22H,12-13H2,1-7H3/t18-,19-,20+,21+,22+/m1/s1 |
| InChIKey | LNALIZBWLSGGNP-AANPDWTMSA-N |
| XLogP | 2.40 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|