C22H28O11 — CID 169105681
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[4-(hydroxymethyl)phenyl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 169105681) has the molecular formula C22H28O11 and a molecular weight of 468.46 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[4-(hydroxymethyl)phenyl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[4-(hydroxymethyl)phenyl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 169105681 |
| Molecular Formula | C22H28O11 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[4-(hydroxymethyl)phenyl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCc2ccc(CO)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H28O11/c1-12(24)28-11-18-19(30-13(2)25)20(31-14(3)26)21(32-15(4)27)22(33-18)29-10-17-7-5-16(9-23)6-8-17/h5-8,18-23H,9-11H2,1-4H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | QFGXNFSGCBKAPB-QMCAAQAGSA-N |
| XLogP | 0.78 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|