C21H26O11 — CID 14837935
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(2-hydroxyphenyl)methoxy]oxan-2-yl]methyl acetate (PubChem CID 14837935) has the molecular formula C21H26O11 and a molecular weight of 454.43 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(2-hydroxyphenyl)methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(2-hydroxyphenyl)methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14837935 |
| Molecular Formula | C21H26O11 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(2-hydroxyphenyl)methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OCc2ccccc2O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H26O11/c1-11(22)27-10-17-18(29-12(2)23)19(30-13(3)24)20(31-14(4)25)21(32-17)28-9-15-7-5-6-8-16(15)26/h5-8,17-21,26H,9-10H2,1-4H3/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | AITSMHCHKWRWHP-AWGDKMGJSA-N |
| XLogP | 0.99 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|