C24H40O10 — CID 101180904
[(2R,3S,4S,5R,6S)-3-acetyloxy-4,5-bis(2,2-dimethylpropanoyloxy)-6-methoxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 101180904) has the molecular formula C24H40O10 and a molecular weight of 488.57 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3-acetyloxy-4,5-bis(2,2-dimethylpropanoyloxy)-6-methoxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3-acetyloxy-4,5-bis(2,2-dimethylpropanoyloxy)-6-methoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101180904 |
| Molecular Formula | C24H40O10 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3-acetyloxy-4,5-bis(2,2-dimethylpropanoyloxy)-6-methoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CO[C@H]1O[C@H](COC(=O)C(C)(C)C)[C@H](OC(C)=O)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H40O10/c1-13(25)31-15-14(12-30-19(26)22(2,3)4)32-18(29-11)17(34-21(28)24(8,9)10)16(15)33-20(27)23(5,6)7/h14-18H,12H2,1-11H3/t14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | JBGJIJHPYLNNIL-ICUGJSFKSA-N |
| XLogP | 2.79 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|