C15H10F12O10 — CID 550492
[6-methoxy-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 550492) has the molecular formula C15H10F12O10 and a molecular weight of 578.21 g/mol. Its IUPAC name is [6-methoxy-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [6-methoxy-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 550492 |
| Molecular Formula | C15H10F12O10 |
| Molecular Weight | 578.21 g/mol |
| Exact Mass | 578.01 |
| IUPAC Name | [6-methoxy-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | COC1OC(COC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H10F12O10/c1-32-7-6(37-11(31)15(25,26)27)5(36-10(30)14(22,23)24)4(35-9(29)13(19,20)21)3(34-7)2-33-8(28)12(16,17)18/h3-7H,2H2,1H3 |
| InChIKey | WMQMWWATOFEKAA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|