C26H47N5O11 — CID 10677799
[(2R,3S,4S,5R,6R)-3,4,5,6-tetrakis[(2-amino-2-methylpropanoyl)oxy]oxan-2-yl]methyl 2-amino-2-methylpropanoate (PubChem CID 10677799) has the molecular formula C26H47N5O11 and a molecular weight of 605.69 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5,6-tetrakis[(2-amino-2-methylpropanoyl)oxy]oxan-2-yl]methyl 2-amino-2-methylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5,6-tetrakis[(2-amino-2-methylpropanoyl)oxy]oxan-2-yl]methyl 2-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 10677799 |
| Molecular Formula | C26H47N5O11 |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 605.33 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5,6-tetrakis[(2-amino-2-methylpropanoyl)oxy]oxan-2-yl]methyl 2-amino-2-methylpropanoate |
| SMILES | CC(C)(N)C(=O)OC[C@H]1O[C@H](OC(=O)C(C)(C)N)[C@H](OC(=O)C(C)(C)N)[C@@H](OC(=O)C(C)(C)N)[C@H]1OC(=O)C(C)(C)N |
| InChI | InChI=1S/C26H47N5O11/c1-22(2,27)17(32)37-11-12-13(39-18(33)23(3,4)28)14(40-19(34)24(5,6)29)15(41-20(35)25(7,8)30)16(38-12)42-21(36)26(9,10)31/h12-16H,11,27-31H2,1-10H3/t12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | PMTSLCFRCWMOQV-LYYZXLFJSA-N |
| XLogP | -1.78 |
| TPSA | 270.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|