C28H44Cl3NO10 — CID 177406281
[(2R,3R,4S,5S,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 177406281) has the molecular formula C28H44Cl3NO10 and a molecular weight of 661.02 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 177406281 |
| Molecular Formula | C28H44Cl3NO10 |
| Molecular Weight | 661.02 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C28H44Cl3NO10/c1-24(2,3)20(33)37-13-14-15(39-21(34)25(4,5)6)16(40-22(35)26(7,8)9)17(41-23(36)27(10,11)12)18(38-14)42-19(32)28(29,30)31/h14-18,32H,13H2,1-12H3/b32-19+/t14-,15-,16+,17+,18-/m1/s1 |
| InChIKey | WOSWCYLUSZNKFK-BELKIHAWSA-N |
| XLogP | 5.54 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.02 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|