C27H34O7SSi — CID 91077201
[(2R,3R,4S,5R)-4-acetyloxy-5-acetylsulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 91077201) has the molecular formula C27H34O7SSi and a molecular weight of 530.72 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-acetyloxy-5-acetylsulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-4-acetyloxy-5-acetylsulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 91077201 |
| Molecular Formula | C27H34O7SSi |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [(2R,3R,4S,5R)-4-acetyloxy-5-acetylsulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]1SC(C)=O |
| InChI | InChI=1S/C27H34O7SSi/c1-18(28)32-24-23(34-26(35-20(3)30)25(24)33-19(2)29)17-31-36(27(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,23-26H,17H2,1-6H3/t23-,24-,25+,26-/m1/s1 |
| InChIKey | DGFZTWQVCMEBOD-FXSWLTOZSA-N |
| XLogP | 3.43 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|