C32H45NO7SSi — CID 20739074
4-[2-[3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dimethyloxan-2-yl]sulfanylethylamino]-4-oxobutanoic acid (PubChem CID 20739074) has the molecular formula C32H45NO7SSi and a molecular weight of 615.87 g/mol. Its IUPAC name is 4-[2-[3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dimethyloxan-2-yl]sulfanylethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dimethyloxan-2-yl]sulfanylethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20739074 |
| Molecular Formula | C32H45NO7SSi |
| Molecular Weight | 615.87 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | 4-[2-[3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dimethyloxan-2-yl]sulfanylethylamino]-4-oxobutanoic acid |
| SMILES | CC(=O)OC1C(SCCNC(=O)CCC(=O)O)OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(C)C1C |
| InChI | InChI=1S/C32H45NO7SSi/c1-22-23(2)30(39-24(3)34)31(41-20-19-33-28(35)17-18-29(36)37)40-27(22)21-38-42(32(4,5)6,25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-16,22-23,27,30-31H,17-21H2,1-6H3,(H,33,35)(H,36,37) |
| InChIKey | ITIVFDIHYIUCCI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.87 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|