C40H50O7Si2 — CID 134931192
[(3S,4R,5R,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dihydroxyoxan-3-yl] acetate (PubChem CID 134931192) has the molecular formula C40H50O7Si2 and a molecular weight of 699.01 g/mol. Its IUPAC name is [(3S,4R,5R,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dihydroxyoxan-3-yl] acetate.
| Compound Name | [(3S,4R,5R,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 134931192 |
| Molecular Formula | C40H50O7Si2 |
| Molecular Weight | 699.01 g/mol |
| Exact Mass | 698.31 |
| IUPAC Name | [(3S,4R,5R,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dihydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(O)O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C40H50O7Si2/c1-29(41)45-37-35(42)36(47-49(40(5,6)7,32-24-16-10-17-25-32)33-26-18-11-19-27-33)34(46-38(37)43)28-44-48(39(2,3)4,30-20-12-8-13-21-30)31-22-14-9-15-23-31/h8-27,34-38,42-43H,28H2,1-7H3/t34-,35-,36-,37-,38?/m0/s1 |
| InChIKey | DKGGVQDXBAFMCY-HAFAKCMCSA-N |
| XLogP | 4.52 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.01 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|