C35H42O8Si — CID 171122685
[(2R,3S,4S,5R,6R)-5-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-4-prop-2-enoxyoxan-3-yl] 4-methylbenzoate (PubChem CID 171122685) has the molecular formula C35H42O8Si and a molecular weight of 618.80 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-4-prop-2-enoxyoxan-3-yl] 4-methylbenzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-4-prop-2-enoxyoxan-3-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 171122685 |
| Molecular Formula | C35H42O8Si |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-4-prop-2-enoxyoxan-3-yl] 4-methylbenzoate |
| SMILES | C=CCO[C@@H]1[C@@H](OC(C)=O)[C@H](O)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H42O8Si/c1-7-22-39-31-30(43-33(37)26-20-18-24(2)19-21-26)29(42-34(38)32(31)41-25(3)36)23-40-44(35(4,5)6,27-14-10-8-11-15-27)28-16-12-9-13-17-28/h7-21,29-32,34,38H,1,22-23H2,2-6H3/t29-,30+,31+,32-,34-/m1/s1 |
| InChIKey | YIPMOASLCALCGZ-BWMDDLPLSA-N |
| XLogP | 4.32 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|