C28H32O5Si — CID 171122774
[(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl] benzoate (PubChem CID 171122774) has the molecular formula C28H32O5Si and a molecular weight of 476.65 g/mol. Its IUPAC name is [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl] benzoate.
| Compound Name | [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 171122774 |
| Molecular Formula | C28H32O5Si |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl] benzoate |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC(O)C[C@@H]1OC(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O5Si/c1-28(2,3)34(22-15-9-5-10-16-22,23-17-11-6-12-18-23)31-20-25-24(19-26(29)32-25)33-27(30)21-13-7-4-8-14-21/h4-18,24-26,29H,19-20H2,1-3H3/t24-,25+,26?/m0/s1 |
| InChIKey | KVPLVJOSWLBWDM-LHJLODMPSA-N |
| XLogP | 3.90 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|