C29H34O5Si — CID 59157894
[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxyoxolan-3-yl] benzoate (PubChem CID 59157894) has the molecular formula C29H34O5Si and a molecular weight of 490.67 g/mol. Its IUPAC name is [(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxyoxolan-3-yl] benzoate.
| Compound Name | [(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 59157894 |
| Molecular Formula | C29H34O5Si |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | [(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxyoxolan-3-yl] benzoate |
| SMILES | COC1CC(OC(=O)c2ccccc2)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C29H34O5Si/c1-29(2,3)35(23-16-10-6-11-17-23,24-18-12-7-13-19-24)32-21-26-25(20-27(31-4)33-26)34-28(30)22-14-8-5-9-15-22/h5-19,25-27H,20-21H2,1-4H3/t25?,26-,27?/m0/s1 |
| InChIKey | KZHXHPQNIHMOKS-QLLQDVQFSA-N |
| XLogP | 4.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|