C22H24O7 — CID 70918304
[(2R,5R)-3-benzoyloxy-5-(2-hydroxypropan-2-yloxy)oxolan-2-yl]methyl benzoate (PubChem CID 70918304) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is [(2R,5R)-3-benzoyloxy-5-(2-hydroxypropan-2-yloxy)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,5R)-3-benzoyloxy-5-(2-hydroxypropan-2-yloxy)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 70918304 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [(2R,5R)-3-benzoyloxy-5-(2-hydroxypropan-2-yloxy)oxolan-2-yl]methyl benzoate |
| SMILES | CC(C)(O)O[C@@H]1CC(OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C22H24O7/c1-22(2,25)29-19-13-17(28-21(24)16-11-7-4-8-12-16)18(27-19)14-26-20(23)15-9-5-3-6-10-15/h3-12,17-19,25H,13-14H2,1-2H3/t17?,18-,19-/m1/s1 |
| InChIKey | KOGOHMCNGUUYJD-OMKBGSMGSA-N |
| XLogP | 2.93 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|