C20H17NO5 — CID 11100232
[(2R,3S,5S)-3-benzoyloxy-5-cyanooxolan-2-yl]methyl benzoate (PubChem CID 11100232) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is [(2R,3S,5S)-3-benzoyloxy-5-cyanooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5S)-3-benzoyloxy-5-cyanooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11100232 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [(2R,3S,5S)-3-benzoyloxy-5-cyanooxolan-2-yl]methyl benzoate |
| SMILES | N#C[C@@H]1C[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C20H17NO5/c21-12-16-11-17(26-20(23)15-9-5-2-6-10-15)18(25-16)13-24-19(22)14-7-3-1-4-8-14/h1-10,16-18H,11,13H2/t16-,17-,18+/m0/s1 |
| InChIKey | SNYLJLLCAXQRJF-OKZBNKHCSA-N |
| XLogP | 2.75 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |