C27H23BrO7 — CID 70579927
[(2R,3R,4S,6R)-3,4-dibenzoyloxy-6-bromooxan-2-yl]methyl benzoate (PubChem CID 70579927) has the molecular formula C27H23BrO7 and a molecular weight of 539.38 g/mol. Its IUPAC name is [(2R,3R,4S,6R)-3,4-dibenzoyloxy-6-bromooxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,6R)-3,4-dibenzoyloxy-6-bromooxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 70579927 |
| Molecular Formula | C27H23BrO7 |
| Molecular Weight | 539.38 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | [(2R,3R,4S,6R)-3,4-dibenzoyloxy-6-bromooxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@H](Br)C[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H23BrO7/c28-23-16-21(34-26(30)19-12-6-2-7-13-19)24(35-27(31)20-14-8-3-9-15-20)22(33-23)17-32-25(29)18-10-4-1-5-11-18/h1-15,21-24H,16-17H2/t21-,22+,23-,24+/m0/s1 |
| InChIKey | QBFKMNHCXUOYHY-UARRHKHWSA-N |
| XLogP | 4.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|