C27H23BrO8 — CID 67631238
[(2S,4S,5R,6R)-4,5-dibenzoyloxy-6-bromooxyoxan-2-yl]methyl benzoate (PubChem CID 67631238) has the molecular formula C27H23BrO8 and a molecular weight of 555.38 g/mol. Its IUPAC name is [(2S,4S,5R,6R)-4,5-dibenzoyloxy-6-bromooxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2S,4S,5R,6R)-4,5-dibenzoyloxy-6-bromooxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 67631238 |
| Molecular Formula | C27H23BrO8 |
| Molecular Weight | 555.38 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | [(2S,4S,5R,6R)-4,5-dibenzoyloxy-6-bromooxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1C[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H](OBr)O1)c1ccccc1 |
| InChI | InChI=1S/C27H23BrO8/c28-36-27-23(35-26(31)20-14-8-3-9-15-20)22(34-25(30)19-12-6-2-7-13-19)16-21(33-27)17-32-24(29)18-10-4-1-5-11-18/h1-15,21-23,27H,16-17H2/t21-,22-,23+,27+/m0/s1 |
| InChIKey | AAGBJIJHYOOYFS-OJXRJRMYSA-N |
| XLogP | 4.74 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|