C42H39NO8 — CID 68989726
[(2S,4S,5R,6R)-6-[5-amino-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxyoxan-2-yl]methyl benzoate (PubChem CID 68989726) has the molecular formula C42H39NO8 and a molecular weight of 685.77 g/mol. Its IUPAC name is [(2S,4S,5R,6R)-6-[5-amino-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2S,4S,5R,6R)-6-[5-amino-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 68989726 |
| Molecular Formula | C42H39NO8 |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.27 |
| IUPAC Name | [(2S,4S,5R,6R)-6-[5-amino-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxyoxan-2-yl]methyl benzoate |
| SMILES | CCc1ccc(Cc2ccc(N)cc2O[C@H]2O[C@H](COC(=O)c3ccccc3)C[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H39NO8/c1-2-28-18-20-29(21-19-28)24-33-22-23-34(43)25-36(33)50-42-38(51-41(46)32-16-10-5-11-17-32)37(49-40(45)31-14-8-4-9-15-31)26-35(48-42)27-47-39(44)30-12-6-3-7-13-30/h3-23,25,35,37-38,42H,2,24,26-27,43H2,1H3/t35-,37-,38+,42+/m0/s1 |
| InChIKey | CMZXAUISSFIJTF-BZFDZXACSA-N |
| XLogP | 7.22 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|