C45H42O10 — CID 68989652
[(2S,3R,4S,5R,6R)-6-[5-acetyloxy-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxy-3-methyloxan-2-yl]methyl benzoate (PubChem CID 68989652) has the molecular formula C45H42O10 and a molecular weight of 742.82 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-6-[5-acetyloxy-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxy-3-methyloxan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-6-[5-acetyloxy-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxy-3-methyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 68989652 |
| Molecular Formula | C45H42O10 |
| Molecular Weight | 742.82 g/mol |
| Exact Mass | 742.28 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-6-[5-acetyloxy-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxy-3-methyloxan-2-yl]methyl benzoate |
| SMILES | CCc1ccc(Cc2ccc(OC(C)=O)cc2O[C@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](C)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H42O10/c1-4-31-20-22-32(23-21-31)26-36-24-25-37(51-30(3)46)27-38(36)52-45-41(55-44(49)35-18-12-7-13-19-35)40(54-43(48)34-16-10-6-11-17-34)29(2)39(53-45)28-50-42(47)33-14-8-5-9-15-33/h5-25,27,29,39-41,45H,4,26,28H2,1-3H3/t29-,39-,40+,41-,45+/m1/s1 |
| InChIKey | DLQTWEUOOJJVTP-ZNMJACMRSA-N |
| XLogP | 7.81 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.82 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|