C30H37NO10 — CID 68873275
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[(4-ethylphenyl)methyl]-5-(methylamino)phenoxy]oxan-2-yl]methyl acetate (PubChem CID 68873275) has the molecular formula C30H37NO10 and a molecular weight of 571.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[(4-ethylphenyl)methyl]-5-(methylamino)phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[(4-ethylphenyl)methyl]-5-(methylamino)phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68873275 |
| Molecular Formula | C30H37NO10 |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[(4-ethylphenyl)methyl]-5-(methylamino)phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CCc1ccc(Cc2ccc(NC)cc2O[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C30H37NO10/c1-7-21-8-10-22(11-9-21)14-23-12-13-24(31-6)15-25(23)40-30-29(39-20(5)35)28(38-19(4)34)27(37-18(3)33)26(41-30)16-36-17(2)32/h8-13,15,26-31H,7,14,16H2,1-6H3/t26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | MBLDSGOSBRVMEB-RLXMVLCYSA-N |
| XLogP | 3.34 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|