C38H43NO12 — CID 23577062
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-ethylphenyl)methyl]-5-[methyl(phenylmethoxycarbonyl)amino]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 23577062) has the molecular formula C38H43NO12 and a molecular weight of 705.76 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-ethylphenyl)methyl]-5-[methyl(phenylmethoxycarbonyl)amino]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-ethylphenyl)methyl]-5-[methyl(phenylmethoxycarbonyl)amino]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23577062 |
| Molecular Formula | C38H43NO12 |
| Molecular Weight | 705.76 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-ethylphenyl)methyl]-5-[methyl(phenylmethoxycarbonyl)amino]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CCc1ccc(Cc2ccc(N(C)C(=O)OCc3ccccc3)cc2O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C38H43NO12/c1-7-27-13-15-28(16-14-27)19-30-17-18-31(39(6)38(44)46-21-29-11-9-8-10-12-29)20-32(30)50-37-36(49-26(5)43)35(48-25(4)42)34(47-24(3)41)33(51-37)22-45-23(2)40/h8-18,20,33-37H,7,19,21-22H2,1-6H3/t33-,34-,35+,36-,37-/m1/s1 |
| InChIKey | FYTUMSZYPMKETR-KHKVHWIZSA-N |
| XLogP | 5.07 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.76 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|