C46H44O11 — CID 68985042
[(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxy-3-methoxyoxan-2-yl]methyl benzoate (PubChem CID 68985042) has the molecular formula C46H44O11 and a molecular weight of 772.85 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxy-3-methoxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxy-3-methoxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 68985042 |
| Molecular Formula | C46H44O11 |
| Molecular Weight | 772.85 g/mol |
| Exact Mass | 772.29 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-2-[(4-ethylphenyl)methyl]phenoxy]-4,5-dibenzoyloxy-3-methoxyoxan-2-yl]methyl benzoate |
| SMILES | CCc1ccc(Cc2ccc(COC(C)=O)cc2O[C@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H44O11/c1-4-31-20-22-32(23-21-31)26-37-25-24-33(28-52-30(2)47)27-38(37)54-46-42(57-45(50)36-18-12-7-13-19-36)41(56-44(49)35-16-10-6-11-17-35)40(51-3)39(55-46)29-53-43(48)34-14-8-5-9-15-34/h5-25,27,39-42,46H,4,26,28-29H2,1-3H3/t39-,40-,41+,42-,46+/m1/s1 |
| InChIKey | KTAIEPUFAHPBOO-LJXAOMJASA-N |
| XLogP | 7.33 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.85 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|