C33H38N2O10 — CID 91571634
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-phenylpyrazol-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 91571634) has the molecular formula C33H38N2O10 and a molecular weight of 622.67 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-phenylpyrazol-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-phenylpyrazol-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91571634 |
| Molecular Formula | C33H38N2O10 |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-phenylpyrazol-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CCc1ccc(Cc2c(OC3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)nn(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C33H38N2O10/c1-7-24-13-15-25(16-14-24)17-27-19(2)35(26-11-9-8-10-12-26)34-32(27)45-33-31(43-23(6)39)30(42-22(5)38)29(41-21(4)37)28(44-33)18-40-20(3)36/h8-16,28-31,33H,7,17-18H2,1-6H3/t28-,29-,30+,31-,33?/m1/s1 |
| InChIKey | LAEDQNRCDDNFJJ-PTIDGSBYSA-N |
| XLogP | 3.80 |
| TPSA | 141.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|