C26H30N2O12 — CID 102078215
2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl 1-phenylimidazole-4-carboxylate (PubChem CID 102078215) has the molecular formula C26H30N2O12 and a molecular weight of 562.53 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl 1-phenylimidazole-4-carboxylate.
| Compound Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl 1-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 102078215 |
| Molecular Formula | C26H30N2O12 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl 1-phenylimidazole-4-carboxylate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCOC(=O)c2cn(-c3ccccc3)cn2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H30N2O12/c1-15(29)36-13-21-22(37-16(2)30)23(38-17(3)31)24(39-18(4)32)26(40-21)35-11-10-34-25(33)20-12-28(14-27-20)19-8-6-5-7-9-19/h5-9,12,14,21-24,26H,10-11,13H2,1-4H3/t21-,22+,23+,24-,26-/m1/s1 |
| InChIKey | GWJSXZXHVORALP-IUSCBXDMSA-N |
| XLogP | 1.13 |
| TPSA | 167.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|