C26H32N2O11 — CID 90943489
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[(4-methoxyphenyl)methyl]-5-methyl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 90943489) has the molecular formula C26H32N2O11 and a molecular weight of 548.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[(4-methoxyphenyl)methyl]-5-methyl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[(4-methoxyphenyl)methyl]-5-methyl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90943489 |
| Molecular Formula | C26H32N2O11 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[(4-methoxyphenyl)methyl]-5-methyl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(Cc2c(OC3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)n[nH]c2C)cc1 |
| InChI | InChI=1S/C26H32N2O11/c1-13-20(11-18-7-9-19(33-6)10-8-18)25(28-27-13)39-26-24(37-17(5)32)23(36-16(4)31)22(35-15(3)30)21(38-26)12-34-14(2)29/h7-10,21-24,26H,11-12H2,1-6H3,(H,27,28)/t21-,22-,23+,24-,26?/m1/s1 |
| InChIKey | NPZDTDIZBPTDMD-HGXYQMEISA-N |
| XLogP | 1.78 |
| TPSA | 161.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|