C38H48N2O12 — CID 68943207
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-(4-phenylmethoxybutoxy)phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 68943207) has the molecular formula C38H48N2O12 and a molecular weight of 724.80 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-(4-phenylmethoxybutoxy)phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-(4-phenylmethoxybutoxy)phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68943207 |
| Molecular Formula | C38H48N2O12 |
| Molecular Weight | 724.80 g/mol |
| Exact Mass | 724.32 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-(4-phenylmethoxybutoxy)phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2n[nH]c(C(C)C)c2Cc2ccc(OCCCCOCc3ccccc3)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C38H48N2O12/c1-23(2)33-31(20-28-14-16-30(17-15-28)46-19-11-10-18-45-21-29-12-8-7-9-13-29)37(40-39-33)52-38-36(50-27(6)44)35(49-26(5)43)34(48-25(4)42)32(51-38)22-47-24(3)41/h7-9,12-17,23,32,34-36,38H,10-11,18-22H2,1-6H3,(H,39,40)/t32-,34-,35+,36-,38+/m1/s1 |
| InChIKey | DHLKAVDTBFLKJD-VKTDQVFKSA-N |
| XLogP | 4.96 |
| TPSA | 170.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.80 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|